C20H17F2N5O — CID 123146186
2-(2-fluorophenyl)-6-N-(2-fluoro-4-pyridinyl)-4-N-(3-oxabicyclo[3.1.0]hexan-6-yl)pyrimidine-4,6-diamine (PubChem CID 123146186) has the molecular formula C20H17F2N5O and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-6-N-(2-fluoro-4-pyridinyl)-4-N-(3-oxabicyclo[3.1.0]hexan-6-yl)pyrimidine-4,6-diamine.
| Compound Name | 2-(2-fluorophenyl)-6-N-(2-fluoro-4-pyridinyl)-4-N-(3-oxabicyclo[3.1.0]hexan-6-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 123146186 |
| Molecular Formula | C20H17F2N5O |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 2-(2-fluorophenyl)-6-N-(2-fluoro-4-pyridinyl)-4-N-(3-oxabicyclo[3.1.0]hexan-6-yl)pyrimidine-4,6-diamine |
| SMILES | Fc1cc(Nc2cc(NC3C4COCC43)nc(-c3ccccc3F)n2)ccn1 |
| InChI | InChI=1S/C20H17F2N5O/c21-15-4-2-1-3-12(15)20-26-17(24-11-5-6-23-16(22)7-11)8-18(27-20)25-19-13-9-28-10-14(13)19/h1-8,13-14,19H,9-10H2,(H2,23,24,25,26,27) |
| InChIKey | BZMOXHPVJJEHLJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|