C21H19NO3S2 — CID 123146559
3-ethenylperoxy-2-sulfanylidene-5-[[4-(2,4,6-trimethylphenyl)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 123146559) has the molecular formula C21H19NO3S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 3-ethenylperoxy-2-sulfanylidene-5-[[4-(2,4,6-trimethylphenyl)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-ethenylperoxy-2-sulfanylidene-5-[[4-(2,4,6-trimethylphenyl)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123146559 |
| Molecular Formula | C21H19NO3S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 3-ethenylperoxy-2-sulfanylidene-5-[[4-(2,4,6-trimethylphenyl)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | C=COON1C(=O)C(=Cc2ccc(-c3c(C)cc(C)cc3C)cc2)SC1=S |
| InChI | InChI=1S/C21H19NO3S2/c1-5-24-25-22-20(23)18(27-21(22)26)12-16-6-8-17(9-7-16)19-14(3)10-13(2)11-15(19)4/h5-12H,1H2,2-4H3 |
| InChIKey | ZOYXKWNGXXPILQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|