About N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine
N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine (PubChem CID 123147504) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine |
| PubChem CID | 123147504 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine |
| SMILES | C=C1C=CC=C/C1=N\C=C(C)CC |
| InChI | InChI=1S/C12H15N/c1-4-10(2)9-13-12-8-6-5-7-11(12)3/h5-9H,3-4H2,1-2H3/b10-9?,13-12+ |
| InChIKey | LYNLHFBRPSSRHH-BMSCJNEBSA-N |
| XLogP | 3.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine?
The IUPAC name of N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine (CID 123147504) is N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine.
What is the SMILES notation for N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine?
The canonical SMILES for N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine is C=C1C=CC=C/C1=N\C=C(C)CC.
What is the InChIKey of N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine?
The InChIKey is LYNLHFBRPSSRHH-BMSCJNEBSA-N. The full InChI is InChI=1S/C12H15N/c1-4-10(2)9-13-12-8-6-5-7-11(12)3/h5-9H,3-4H2,1-2H3/b10-9?,13-12+.
What are the key properties of N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine?
N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine has a molecular weight of 173.26 g/mol, XLogP of 3.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylbut-1-enyl)-6-methylidenecyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 123147504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).