C12H23NS — CID 123147571
N-[5-[ethyl(dimethyl)-λ4-sulfanyl]hexa-2,5-dienyl]ethanimine (PubChem CID 123147571) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is N-[5-[ethyl(dimethyl)-λ4-sulfanyl]hexa-2,5-dienyl]ethanimine.
| Compound Name | N-[5-[ethyl(dimethyl)-λ4-sulfanyl]hexa-2,5-dienyl]ethanimine |
|---|---|
| PubChem CID | 123147571 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | N-[5-[ethyl(dimethyl)-λ4-sulfanyl]hexa-2,5-dienyl]ethanimine |
| SMILES | C=C(CC=CC/N=C/C)S(C)(C)CC |
| InChI | InChI=1S/C12H23NS/c1-6-13-11-9-8-10-12(3)14(4,5)7-2/h6,8-9H,3,7,10-11H2,1-2,4-5H3/b9-8?,13-6+ |
| InChIKey | YZHZLIIBEGYWHH-HHYXCLOKSA-N |
| XLogP | 3.62 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|