C8H13NS — CID 142847826
2,5,7-trimethyl-2,5-dihydro-1,4-thiazepine (PubChem CID 142847826) has the molecular formula C8H13NS and a molecular weight of 155.27 g/mol. Its IUPAC name is 2,5,7-trimethyl-2,5-dihydro-1,4-thiazepine.
| Compound Name | 2,5,7-trimethyl-2,5-dihydro-1,4-thiazepine |
|---|---|
| PubChem CID | 142847826 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2,5,7-trimethyl-2,5-dihydro-1,4-thiazepine |
| SMILES | CC1=CC(C)N=CC(C)S1 |
| InChI | InChI=1S/C8H13NS/c1-6-4-7(2)10-8(3)5-9-6/h4-6,8H,1-3H3 |
| InChIKey | HUZGIVCRGIMMBP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |