C9H20N2S — CID 123147892
N,N'-diethyl-N-(1-methylsulfanylpropyl)methanimidamide (PubChem CID 123147892) has the molecular formula C9H20N2S and a molecular weight of 188.34 g/mol. Its IUPAC name is N,N'-diethyl-N-(1-methylsulfanylpropyl)methanimidamide.
| Compound Name | N,N'-diethyl-N-(1-methylsulfanylpropyl)methanimidamide |
|---|---|
| PubChem CID | 123147892 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N,N'-diethyl-N-(1-methylsulfanylpropyl)methanimidamide |
| SMILES | CC/N=C/N(CC)C(CC)SC |
| InChI | InChI=1S/C9H20N2S/c1-5-9(12-4)11(7-3)8-10-6-2/h8-9H,5-7H2,1-4H3/b10-8+ |
| InChIKey | YEGKGDSMZRYKER-CSKARUKUSA-N |
| XLogP | 2.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|