C9H20N2S — CID 143435711
N,N-diethyl-4,5-dihydro-1,3-thiazol-2-amine;ethane (PubChem CID 143435711) has the molecular formula C9H20N2S and a molecular weight of 188.34 g/mol. Its IUPAC name is N,N-diethyl-4,5-dihydro-1,3-thiazol-2-amine;ethane.
| Compound Name | N,N-diethyl-4,5-dihydro-1,3-thiazol-2-amine;ethane |
|---|---|
| PubChem CID | 143435711 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N,N-diethyl-4,5-dihydro-1,3-thiazol-2-amine;ethane |
| SMILES | CC.CCN(CC)C1=NCCS1 |
| InChI | InChI=1S/C7H14N2S.C2H6/c1-3-9(4-2)7-8-5-6-10-7;1-2/h3-6H2,1-2H3;1-2H3 |
| InChIKey | MNAYUFHNUNAHME-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |