C6H11N3S — CID 10607023
N'-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylmethanimidamide (PubChem CID 10607023) has the molecular formula C6H11N3S and a molecular weight of 157.24 g/mol. Its IUPAC name is N'-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 10607023 |
| Molecular Formula | C6H11N3S |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/C1=NCCS1 |
| InChI | InChI=1S/C6H11N3S/c1-9(2)5-8-6-7-3-4-10-6/h5H,3-4H2,1-2H3/b8-5+ |
| InChIKey | JVDFMLRLFAXIFC-VMPITWQZSA-N |
| XLogP | 0.68 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|