C7H13N3S — CID 11240743
N'-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylethanimidamide (PubChem CID 11240743) has the molecular formula C7H13N3S and a molecular weight of 171.27 g/mol. Its IUPAC name is N'-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylethanimidamide.
| Compound Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylethanimidamide |
|---|---|
| PubChem CID | 11240743 |
| Molecular Formula | C7H13N3S |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | N'-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylethanimidamide |
| SMILES | C/C(=N\C1=NCCS1)N(C)C |
| InChI | InChI=1S/C7H13N3S/c1-6(10(2)3)9-7-8-4-5-11-7/h4-5H2,1-3H3/b9-6+ |
| InChIKey | CDPIFSFDBXJXKN-RMKNXTFCSA-N |
| XLogP | 1.07 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|