C5H8N2OS — CID 137156416
(NZ)-N-(5-methyl-2,3-dihydro-1,4-thiazin-6-ylidene)hydroxylamine (PubChem CID 137156416) has the molecular formula C5H8N2OS and a molecular weight of 144.20 g/mol. Its IUPAC name is (NZ)-N-(5-methyl-2,3-dihydro-1,4-thiazin-6-ylidene)hydroxylamine.
| Compound Name | (NZ)-N-(5-methyl-2,3-dihydro-1,4-thiazin-6-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 137156416 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | (NZ)-N-(5-methyl-2,3-dihydro-1,4-thiazin-6-ylidene)hydroxylamine |
| SMILES | CC1=NCCS/C1=N\O |
| InChI | InChI=1S/C5H8N2OS/c1-4-5(7-8)9-3-2-6-4/h8H,2-3H2,1H3/b7-5- |
| InChIKey | GODMMJRZJGBZSA-ALCCZGGFSA-N |
| XLogP | 0.98 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|