C5H11NO2SSi — CID 174810247
4,5-dihydro-1,3-thiazol-2-yl(dimethoxy)silane (PubChem CID 174810247) has the molecular formula C5H11NO2SSi and a molecular weight of 177.30 g/mol. Its IUPAC name is 4,5-dihydro-1,3-thiazol-2-yl(dimethoxy)silane.
| Compound Name | 4,5-dihydro-1,3-thiazol-2-yl(dimethoxy)silane |
|---|---|
| PubChem CID | 174810247 |
| Molecular Formula | C5H11NO2SSi |
| Molecular Weight | 177.30 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | 4,5-dihydro-1,3-thiazol-2-yl(dimethoxy)silane |
| SMILES | CO[SiH](OC)C1=NCCS1 |
| InChI | InChI=1S/C5H11NO2SSi/c1-7-10(8-2)5-6-3-4-9-5/h10H,3-4H2,1-2H3 |
| InChIKey | VDPSPIVIAXKNHI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|