C11H14N2S — CID 3024540
4-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylaniline (PubChem CID 3024540) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 4-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylaniline.
| Compound Name | 4-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 3024540 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-(4,5-dihydro-1,3-thiazol-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2=NCCS2)cc1 |
| InChI | InChI=1S/C11H14N2S/c1-13(2)10-5-3-9(4-6-10)11-12-7-8-14-11/h3-6H,7-8H2,1-2H3 |
| InChIKey | XEUKWTMDLFTRPR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |