C15H18N2S — CID 167006849
4-[(1E,3E)-4-(4,5-dihydro-1,3-thiazol-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline (PubChem CID 167006849) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is 4-[(1E,3E)-4-(4,5-dihydro-1,3-thiazol-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline.
| Compound Name | 4-[(1E,3E)-4-(4,5-dihydro-1,3-thiazol-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 167006849 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-[(1E,3E)-4-(4,5-dihydro-1,3-thiazol-2-yl)buta-1,3-dienyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/C=C/C2=NCCS2)cc1 |
| InChI | InChI=1S/C15H18N2S/c1-17(2)14-9-7-13(8-10-14)5-3-4-6-15-16-11-12-18-15/h3-10H,11-12H2,1-2H3/b5-3+,6-4+ |
| InChIKey | UGNNLWTVTHBUPV-GGWOSOGESA-N |
| XLogP | 3.47 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|