C16H20N2S — CID 90135204
N,N-dimethyl-4-[(1E,3E)-4-[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]buta-1,3-dienyl]aniline (PubChem CID 90135204) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is N,N-dimethyl-4-[(1E,3E)-4-[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]buta-1,3-dienyl]aniline.
| Compound Name | N,N-dimethyl-4-[(1E,3E)-4-[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]buta-1,3-dienyl]aniline |
|---|---|
| PubChem CID | 90135204 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | N,N-dimethyl-4-[(1E,3E)-4-[(4S)-4-methyl-4,5-dihydro-1,3-thiazol-2-yl]buta-1,3-dienyl]aniline |
| SMILES | C[C@H]1CSC(/C=C/C=C/c2ccc(N(C)C)cc2)=N1 |
| InChI | InChI=1S/C16H20N2S/c1-13-12-19-16(17-13)7-5-4-6-14-8-10-15(11-9-14)18(2)3/h4-11,13H,12H2,1-3H3/b6-4+,7-5+/t13-/m0/s1 |
| InChIKey | ISOUHGGMCSFJCA-KXBOEMNQSA-N |
| XLogP | 3.86 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|