C8H9N3S2 — CID 67906774
4,5-dihydro-1,3-thiazol-2-yl-(3-methylthiophen-2-yl)diazene (PubChem CID 67906774) has the molecular formula C8H9N3S2 and a molecular weight of 211.31 g/mol. Its IUPAC name is 4,5-dihydro-1,3-thiazol-2-yl-(3-methylthiophen-2-yl)diazene.
| Compound Name | 4,5-dihydro-1,3-thiazol-2-yl-(3-methylthiophen-2-yl)diazene |
|---|---|
| PubChem CID | 67906774 |
| Molecular Formula | C8H9N3S2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.02 |
| IUPAC Name | 4,5-dihydro-1,3-thiazol-2-yl-(3-methylthiophen-2-yl)diazene |
| SMILES | Cc1ccsc1N=NC1=NCCS1 |
| InChI | InChI=1S/C8H9N3S2/c1-6-2-4-12-7(6)10-11-8-9-3-5-13-8/h2,4H,3,5H2,1H3 |
| InChIKey | DKXLVPDSPXUIIL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|