C9H9NO4SW2 — CID 147325545
3,3-dihydroxy-2-[(3-methylthiophen-2-yl)iminomethyl]prop-2-enoic acid;tungsten (PubChem CID 147325545) has the molecular formula C9H9NO4SW2 and a molecular weight of 594.92 g/mol. Its IUPAC name is 3,3-dihydroxy-2-[(3-methylthiophen-2-yl)iminomethyl]prop-2-enoic acid;tungsten.
| Compound Name | 3,3-dihydroxy-2-[(3-methylthiophen-2-yl)iminomethyl]prop-2-enoic acid;tungsten |
|---|---|
| PubChem CID | 147325545 |
| Molecular Formula | C9H9NO4SW2 |
| Molecular Weight | 594.92 g/mol |
| Exact Mass | 594.93 |
| IUPAC Name | 3,3-dihydroxy-2-[(3-methylthiophen-2-yl)iminomethyl]prop-2-enoic acid;tungsten |
| SMILES | Cc1ccsc1N=CC(C(=O)O)=C(O)O.[W].[W] |
| InChI | InChI=1S/C9H9NO4S.2W/c1-5-2-3-15-7(5)10-4-6(8(11)12)9(13)14;;/h2-4,11-12H,1H3,(H,13,14);; |
| InChIKey | BBKFNVGZIFGMTJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.92 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|