C11H16N2O2S — CID 88622581
tert-butyl-[(E)-(3-methylthiophen-2-yl)methylideneamino]carbamic acid (PubChem CID 88622581) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is tert-butyl-[(E)-(3-methylthiophen-2-yl)methylideneamino]carbamic acid.
| Compound Name | tert-butyl-[(E)-(3-methylthiophen-2-yl)methylideneamino]carbamic acid |
|---|---|
| PubChem CID | 88622581 |
| Molecular Formula | C11H16N2O2S |
| Molecular Weight | 240.33 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | tert-butyl-[(E)-(3-methylthiophen-2-yl)methylideneamino]carbamic acid |
| SMILES | Cc1ccsc1/C=N/N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H16N2O2S/c1-8-5-6-16-9(8)7-12-13(10(14)15)11(2,3)4/h5-7H,1-4H3,(H,14,15)/b12-7+ |
| InChIKey | ATQNDVYNVFLUGE-KPKJPENVSA-N |
| XLogP | 3.17 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|