C10H20S — CID 54075062
2,3-dimethylthiophene;ethane (PubChem CID 54075062) has the molecular formula C10H20S and a molecular weight of 172.34 g/mol. Its IUPAC name is 2,3-dimethylthiophene;ethane.
| Compound Name | 2,3-dimethylthiophene;ethane |
|---|---|
| PubChem CID | 54075062 |
| Molecular Formula | C10H20S |
| Molecular Weight | 172.34 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2,3-dimethylthiophene;ethane |
| SMILES | CC.CC.Cc1ccsc1C |
| InChI | InChI=1S/C6H8S.2C2H6/c1-5-3-4-7-6(5)2;2*1-2/h3-4H,1-2H3;2*1-2H3 |
| InChIKey | MJCPPVYXCHDYCT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |