C15H26S2 — CID 144970372
2,3-dimethylthiophene;ethane;3-methylthiophene (PubChem CID 144970372) has the molecular formula C15H26S2 and a molecular weight of 270.51 g/mol. Its IUPAC name is 2,3-dimethylthiophene;ethane;3-methylthiophene.
| Compound Name | 2,3-dimethylthiophene;ethane;3-methylthiophene |
|---|---|
| PubChem CID | 144970372 |
| Molecular Formula | C15H26S2 |
| Molecular Weight | 270.51 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2,3-dimethylthiophene;ethane;3-methylthiophene |
| SMILES | CC.CC.Cc1ccsc1.Cc1ccsc1C |
| InChI | InChI=1S/C6H8S.C5H6S.2C2H6/c1-5-3-4-7-6(5)2;1-5-2-3-6-4-5;2*1-2/h3-4H,1-2H3;2-4H,1H3;2*1-2H3 |
| InChIKey | WYIYLGQXVZGVHZ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |