C5H9N3S — CID 85230222
1-(4,5-dihydro-1,3-thiazol-2-yl)ethylidenehydrazine (PubChem CID 85230222) has the molecular formula C5H9N3S and a molecular weight of 143.22 g/mol. Its IUPAC name is 1-(4,5-dihydro-1,3-thiazol-2-yl)ethylidenehydrazine.
| Compound Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)ethylidenehydrazine |
|---|---|
| PubChem CID | 85230222 |
| Molecular Formula | C5H9N3S |
| Molecular Weight | 143.22 g/mol |
| Exact Mass | 143.05 |
| IUPAC Name | 1-(4,5-dihydro-1,3-thiazol-2-yl)ethylidenehydrazine |
| SMILES | CC(=NN)C1=NCCS1 |
| InChI | InChI=1S/C5H9N3S/c1-4(8-6)5-7-2-3-9-5/h2-3,6H2,1H3 |
| InChIKey | FJNJDWVDOAQLCC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|