C5H11IN2S — CID 90654236
N,3-dimethyl-1,3-thiazolidin-2-imine;hydroiodide (PubChem CID 90654236) has the molecular formula C5H11IN2S and a molecular weight of 258.13 g/mol. Its IUPAC name is N,3-dimethyl-1,3-thiazolidin-2-imine;hydroiodide.
| Compound Name | N,3-dimethyl-1,3-thiazolidin-2-imine;hydroiodide |
|---|---|
| PubChem CID | 90654236 |
| Molecular Formula | C5H11IN2S |
| Molecular Weight | 258.13 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | N,3-dimethyl-1,3-thiazolidin-2-imine;hydroiodide |
| SMILES | C/N=C1\SCCN1C.I |
| InChI | InChI=1S/C5H10N2S.HI/c1-6-5-7(2)3-4-8-5;/h3-4H2,1-2H3;1H/b6-5-; |
| InChIKey | PJCGYHJLJCERBP-YSMBQZINSA-N |
| XLogP | 1.27 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.13 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|