C6H11N3S2 — CID 588342
methyl 2-imino-N-methyl-1,3-thiazolidine-3-carboximidothioate (PubChem CID 588342) has the molecular formula C6H11N3S2 and a molecular weight of 189.31 g/mol. Its IUPAC name is methyl 2-imino-N-methyl-1,3-thiazolidine-3-carboximidothioate.
| Compound Name | methyl 2-imino-N-methyl-1,3-thiazolidine-3-carboximidothioate |
|---|---|
| PubChem CID | 588342 |
| Molecular Formula | C6H11N3S2 |
| Molecular Weight | 189.31 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | methyl 2-imino-N-methyl-1,3-thiazolidine-3-carboximidothioate |
| SMILES | [H]/N=C1\SCCN1/C(=N/C)SC |
| InChI | InChI=1S/C6H11N3S2/c1-8-6(10-2)9-3-4-11-5(9)7/h7H,3-4H2,1-2H3/b7-5-,8-6- |
| InChIKey | QFZGJUNKFVTYNS-SFECMWDFSA-N |
| XLogP | 1.32 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|