C7H15N3S — CID 54185934
N,N-dimethyl-1-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]methanamine (PubChem CID 54185934) has the molecular formula C7H15N3S and a molecular weight of 173.28 g/mol. Its IUPAC name is N,N-dimethyl-1-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]methanamine.
| Compound Name | N,N-dimethyl-1-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]methanamine |
|---|---|
| PubChem CID | 54185934 |
| Molecular Formula | C7H15N3S |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | N,N-dimethyl-1-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]methanamine |
| SMILES | CN(C)CN=C1SCCN1C |
| InChI | InChI=1S/C7H15N3S/c1-9(2)6-8-7-10(3)4-5-11-7/h4-6H2,1-3H3 |
| InChIKey | PFCNOLZABCTMIX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|