C6H12N2S — CID 12718849
N,3,5-trimethyl-1,3-thiazolidin-2-imine (PubChem CID 12718849) has the molecular formula C6H12N2S and a molecular weight of 144.24 g/mol. Its IUPAC name is N,3,5-trimethyl-1,3-thiazolidin-2-imine.
| Compound Name | N,3,5-trimethyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 12718849 |
| Molecular Formula | C6H12N2S |
| Molecular Weight | 144.24 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | N,3,5-trimethyl-1,3-thiazolidin-2-imine |
| SMILES | C/N=C1\SC(C)CN1C |
| InChI | InChI=1S/C6H12N2S/c1-5-4-8(3)6(7-2)9-5/h5H,4H2,1-3H3/b7-6- |
| InChIKey | BJGRTGBIPZPDED-SREVYHEPSA-N |
| XLogP | 1.04 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|