About methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate
methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate (PubChem CID 134894287) has the molecular formula C7H15N3S
and a molecular weight of 173.28 g/mol. Its IUPAC name is methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate.
Molecular Properties
| Compound Name | methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate |
| PubChem CID | 134894287 |
| Molecular Formula | C7H15N3S |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate |
| SMILES | CC/N=C(/N=C/N(C)C)SC |
| InChI | InChI=1S/C7H15N3S/c1-5-8-7(11-4)9-6-10(2)3/h6H,5H2,1-4H3/b8-7-,9-6+ |
| InChIKey | FTNUZNGLXZJHET-SOKJVCRVSA-N |
| XLogP | 1.32 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate?
The IUPAC name of methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate (CID 134894287) is methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate.
What is the SMILES notation for methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate?
The canonical SMILES for methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate is CC/N=C(/N=C/N(C)C)SC.
What is the InChIKey of methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate?
The InChIKey is FTNUZNGLXZJHET-SOKJVCRVSA-N. The full InChI is InChI=1S/C7H15N3S/c1-5-8-7(11-4)9-6-10(2)3/h6H,5H2,1-4H3/b8-7-,9-6+.
What are the key properties of methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate?
methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate has a molecular weight of 173.28 g/mol, XLogP of 1.32, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (NE)-N-(dimethylaminomethylidene)-N'-ethylcarbamimidothioate is sourced from PubChem (CID 134894287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).