C4H10N2S — CID 123753602
N,N-dimethyl-N'-methylsulfanylmethanimidamide (PubChem CID 123753602) has the molecular formula C4H10N2S and a molecular weight of 118.20 g/mol. Its IUPAC name is N,N-dimethyl-N'-methylsulfanylmethanimidamide.
| Compound Name | N,N-dimethyl-N'-methylsulfanylmethanimidamide |
|---|---|
| PubChem CID | 123753602 |
| Molecular Formula | C4H10N2S |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | N,N-dimethyl-N'-methylsulfanylmethanimidamide |
| SMILES | CSN=CN(C)C |
| InChI | InChI=1S/C4H10N2S/c1-6(2)4-5-7-3/h4H,1-3H3 |
| InChIKey | GGCDPPCGVTXSHE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|