C13H19N3O4 — CID 69326532
diethyl 1-(dimethylaminomethylideneamino)pyrrole-2,5-dicarboxylate (PubChem CID 69326532) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is diethyl 1-(dimethylaminomethylideneamino)pyrrole-2,5-dicarboxylate.
| Compound Name | diethyl 1-(dimethylaminomethylideneamino)pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 69326532 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | diethyl 1-(dimethylaminomethylideneamino)pyrrole-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1ccc(C(=O)OCC)n1N=CN(C)C |
| InChI | InChI=1S/C13H19N3O4/c1-5-19-12(17)10-7-8-11(13(18)20-6-2)16(10)14-9-15(3)4/h7-9H,5-6H2,1-4H3 |
| InChIKey | UCWFECAKJXRFKQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|