C14H18N2O3 — CID 171855014
ethyl (7E)-7-(dimethylaminomethylidene)-8-oxo-5,6-dihydroindolizine-3-carboxylate (PubChem CID 171855014) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is ethyl (7E)-7-(dimethylaminomethylidene)-8-oxo-5,6-dihydroindolizine-3-carboxylate.
| Compound Name | ethyl (7E)-7-(dimethylaminomethylidene)-8-oxo-5,6-dihydroindolizine-3-carboxylate |
|---|---|
| PubChem CID | 171855014 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | ethyl (7E)-7-(dimethylaminomethylidene)-8-oxo-5,6-dihydroindolizine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc2n1CC/C(=C\N(C)C)C2=O |
| InChI | InChI=1S/C14H18N2O3/c1-4-19-14(18)12-6-5-11-13(17)10(9-15(2)3)7-8-16(11)12/h5-6,9H,4,7-8H2,1-3H3/b10-9+ |
| InChIKey | ZJPBLSHJWGPBSP-MDZDMXLPSA-N |
| XLogP | 1.70 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|