C11H18N2O3 — CID 68704855
ethyl (3E)-3-(dimethylaminomethylidene)-4-oxopiperidine-1-carboxylate (PubChem CID 68704855) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is ethyl (3E)-3-(dimethylaminomethylidene)-4-oxopiperidine-1-carboxylate.
| Compound Name | ethyl (3E)-3-(dimethylaminomethylidene)-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 68704855 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | ethyl (3E)-3-(dimethylaminomethylidene)-4-oxopiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=O)/C(=C/N(C)C)C1 |
| InChI | InChI=1S/C11H18N2O3/c1-4-16-11(15)13-6-5-10(14)9(8-13)7-12(2)3/h7H,4-6,8H2,1-3H3/b9-7+ |
| InChIKey | WSOZZGXLSIXFDZ-VQHVLOKHSA-N |
| XLogP | 0.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|