C30H51N3O10 — CID 159161794
1-O-tert-butyl 3-O-ethyl 5-(dimethylaminomethylidene)-4-oxopiperidine-1,3-dicarboxylate;1-O-tert-butyl 3-O-ethyl 4-oxopiperidine-1,3-dicarboxylate;methane (PubChem CID 159161794) has the molecular formula C30H51N3O10 and a molecular weight of 613.75 g/mol. Its IUPAC name is 1-O-tert-butyl 3-O-ethyl 5-(dimethylaminomethylidene)-4-oxopiperidine-1,3-dicarboxylate;1-O-tert-butyl 3-O-ethyl 4-oxopiperidine-1,3-dicarboxylate;methane.
| Compound Name | 1-O-tert-butyl 3-O-ethyl 5-(dimethylaminomethylidene)-4-oxopiperidine-1,3-dicarboxylate;1-O-tert-butyl 3-O-ethyl 4-oxopiperidine-1,3-dicarboxylate;methane |
|---|---|
| PubChem CID | 159161794 |
| Molecular Formula | C30H51N3O10 |
| Molecular Weight | 613.75 g/mol |
| Exact Mass | 613.36 |
| IUPAC Name | 1-O-tert-butyl 3-O-ethyl 5-(dimethylaminomethylidene)-4-oxopiperidine-1,3-dicarboxylate;1-O-tert-butyl 3-O-ethyl 4-oxopiperidine-1,3-dicarboxylate;methane |
| SMILES | C.CCOC(=O)C1CN(C(=O)OC(C)(C)C)CC(=CN(C)C)C1=O.CCOC(=O)C1CN(C(=O)OC(C)(C)C)CCC1=O |
| InChI | InChI=1S/C16H26N2O5.C13H21NO5.CH4/c1-7-22-14(20)12-10-18(15(21)23-16(2,3)4)9-11(13(12)19)8-17(5)6;1-5-18-11(16)9-8-14(7-6-10(9)15)12(17)19-13(2,3)4;/h8,12H,7,9-10H2,1-6H3;9H,5-8H2,1-4H3;1H4 |
| InChIKey | KKORDLKJYZNSHM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 149.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|