C18H20N4O3 — CID 68934272
ethyl 6-(dimethylaminomethylidene)-7-oxo-1-pyridin-2-yl-4,5-dihydroindazole-3-carboxylate (PubChem CID 68934272) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is ethyl 6-(dimethylaminomethylidene)-7-oxo-1-pyridin-2-yl-4,5-dihydroindazole-3-carboxylate.
| Compound Name | ethyl 6-(dimethylaminomethylidene)-7-oxo-1-pyridin-2-yl-4,5-dihydroindazole-3-carboxylate |
|---|---|
| PubChem CID | 68934272 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | ethyl 6-(dimethylaminomethylidene)-7-oxo-1-pyridin-2-yl-4,5-dihydroindazole-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccccn2)c2c1CCC(=CN(C)C)C2=O |
| InChI | InChI=1S/C18H20N4O3/c1-4-25-18(24)15-13-9-8-12(11-21(2)3)17(23)16(13)22(20-15)14-7-5-6-10-19-14/h5-7,10-11H,4,8-9H2,1-3H3 |
| InChIKey | RTNCSZMLVSITCJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|