C13H17NO5 — CID 91480381
ethyl 1-(1-ethoxy-1,3-dioxopropan-2-yl)-5-methylpyrrole-2-carboxylate (PubChem CID 91480381) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is ethyl 1-(1-ethoxy-1,3-dioxopropan-2-yl)-5-methylpyrrole-2-carboxylate.
| Compound Name | ethyl 1-(1-ethoxy-1,3-dioxopropan-2-yl)-5-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 91480381 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethyl 1-(1-ethoxy-1,3-dioxopropan-2-yl)-5-methylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1ccc(C)n1C(C=O)C(=O)OCC |
| InChI | InChI=1S/C13H17NO5/c1-4-18-12(16)10-7-6-9(3)14(10)11(8-15)13(17)19-5-2/h6-8,11H,4-5H2,1-3H3 |
| InChIKey | CQXUBLIRQPXYFC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|