C15H23N3O4 — CID 69327509
diethyl 1-(dimethylaminomethylideneamino)-3,5-dimethylpyrrole-2,4-dicarboxylate (PubChem CID 69327509) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is diethyl 1-(dimethylaminomethylideneamino)-3,5-dimethylpyrrole-2,4-dicarboxylate.
| Compound Name | diethyl 1-(dimethylaminomethylideneamino)-3,5-dimethylpyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 69327509 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | diethyl 1-(dimethylaminomethylideneamino)-3,5-dimethylpyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1c(C)c(C(=O)OCC)n(N=CN(C)C)c1C |
| InChI | InChI=1S/C15H23N3O4/c1-7-21-14(19)12-10(3)13(15(20)22-8-2)18(11(12)4)16-9-17(5)6/h9H,7-8H2,1-6H3 |
| InChIKey | NVVBDAGGQXDKBG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 73.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|