C7H7F7N2O — CID 175127433
N-(dimethylaminomethylidene)-2,2,3,3,4,4,4-heptafluorobutanamide (PubChem CID 175127433) has the molecular formula C7H7F7N2O and a molecular weight of 268.13 g/mol. Its IUPAC name is N-(dimethylaminomethylidene)-2,2,3,3,4,4,4-heptafluorobutanamide.
| Compound Name | N-(dimethylaminomethylidene)-2,2,3,3,4,4,4-heptafluorobutanamide |
|---|---|
| PubChem CID | 175127433 |
| Molecular Formula | C7H7F7N2O |
| Molecular Weight | 268.13 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | N-(dimethylaminomethylidene)-2,2,3,3,4,4,4-heptafluorobutanamide |
| SMILES | CN(C)/C=N/C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H7F7N2O/c1-16(2)3-15-4(17)5(8,9)6(10,11)7(12,13)14/h3H,1-2H3/b15-3+ |
| InChIKey | BJBKNRPUXKRXGM-CRKCGEKBSA-N |
| XLogP | 1.94 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.13 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|