C4H7F3N2O2S — CID 12066207
N,N-dimethyl-N'-(trifluoromethylsulfonyl)methanimidamide (PubChem CID 12066207) has the molecular formula C4H7F3N2O2S and a molecular weight of 204.17 g/mol. Its IUPAC name is N,N-dimethyl-N'-(trifluoromethylsulfonyl)methanimidamide.
| Compound Name | N,N-dimethyl-N'-(trifluoromethylsulfonyl)methanimidamide |
|---|---|
| PubChem CID | 12066207 |
| Molecular Formula | C4H7F3N2O2S |
| Molecular Weight | 204.17 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | N,N-dimethyl-N'-(trifluoromethylsulfonyl)methanimidamide |
| SMILES | CN(C)/C=N/S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H7F3N2O2S/c1-9(2)3-8-12(10,11)4(5,6)7/h3H,1-2H3/b8-3+ |
| InChIKey | PLOKRSCVZMTFOQ-FPYGCLRLSA-N |
| XLogP | 0.43 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|