C11H24N2O3S — CID 139619639
N'-(6-hydroxy-4,4-dimethylhexyl)sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 139619639) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is N'-(6-hydroxy-4,4-dimethylhexyl)sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-(6-hydroxy-4,4-dimethylhexyl)sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 139619639 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N'-(6-hydroxy-4,4-dimethylhexyl)sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | CN(C)C=NS(=O)(=O)CCCC(C)(C)CCO |
| InChI | InChI=1S/C11H24N2O3S/c1-11(2,7-8-14)6-5-9-17(15,16)12-10-13(3)4/h10,14H,5-9H2,1-4H3 |
| InChIKey | JREBCNVIRNZIFS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|