C9H20N2O2S — CID 177399204
N'-butylsulfonyl-N,N-diethylmethanimidamide (PubChem CID 177399204) has the molecular formula C9H20N2O2S and a molecular weight of 220.34 g/mol. Its IUPAC name is N'-butylsulfonyl-N,N-diethylmethanimidamide.
| Compound Name | N'-butylsulfonyl-N,N-diethylmethanimidamide |
|---|---|
| PubChem CID | 177399204 |
| Molecular Formula | C9H20N2O2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N'-butylsulfonyl-N,N-diethylmethanimidamide |
| SMILES | CCCCS(=O)(=O)/N=C/N(CC)CC |
| InChI | InChI=1S/C9H20N2O2S/c1-4-7-8-14(12,13)10-9-11(5-2)6-3/h9H,4-8H2,1-3H3/b10-9+ |
| InChIKey | VIJMUEHCOSACEZ-MDZDMXLPSA-N |
| XLogP | 1.49 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|