About lithium butylsulfonylazanide
lithium butylsulfonylazanide (PubChem CID 141349237) has the molecular formula C4H10LiNO2S
and a molecular weight of 143.14 g/mol. Its IUPAC name is lithium butylsulfonylazanide.
Molecular Properties
| Compound Name | lithium butylsulfonylazanide |
| PubChem CID | 141349237 |
| Molecular Formula | C4H10LiNO2S |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | lithium butylsulfonylazanide |
| SMILES | CCCCS([NH-])(=O)=O.[Li+] |
| InChI | InChI=1S/C4H10NO2S.Li/c1-2-3-4-8(5,6)7;/h2-4H2,1H3,(H-,5,6,7);/q-1;+1 |
| InChIKey | JPQGEGJFZJCHTN-UHFFFAOYSA-N |
| XLogP | -1.83 |
| TPSA | 57.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze lithium butylsulfonylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium butylsulfonylazanide?
The IUPAC name of lithium butylsulfonylazanide (CID 141349237) is lithium butylsulfonylazanide.
What is the SMILES notation for lithium butylsulfonylazanide?
The canonical SMILES for lithium butylsulfonylazanide is CCCCS([NH-])(=O)=O.[Li+].
What is the InChIKey of lithium butylsulfonylazanide?
The InChIKey is JPQGEGJFZJCHTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10NO2S.Li/c1-2-3-4-8(5,6)7;/h2-4H2,1H3,(H-,5,6,7);/q-1;+1.
What are the key properties of lithium butylsulfonylazanide?
lithium butylsulfonylazanide has a molecular weight of 143.14 g/mol, XLogP of -1.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium butylsulfonylazanide is sourced from PubChem (CID 141349237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).