About sodium;butane-1-sulfonic acid;hydroxide
sodium;butane-1-sulfonic acid;hydroxide (PubChem CID 175272255) has the molecular formula C4H11NaO4S
and a molecular weight of 178.18 g/mol. Its IUPAC name is sodium;butane-1-sulfonic acid;hydroxide.
Molecular Properties
| Compound Name | sodium;butane-1-sulfonic acid;hydroxide |
| PubChem CID | 175272255 |
| Molecular Formula | C4H11NaO4S |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | sodium;butane-1-sulfonic acid;hydroxide |
| SMILES | CCCCS(=O)(=O)O.[Na+].[OH-] |
| InChI | InChI=1S/C4H10O3S.Na.H2O/c1-2-3-4-8(5,6)7;;/h2-4H2,1H3,(H,5,6,7);;1H2/q;+1;/p-1 |
| InChIKey | OLQHNSZWLPRPID-UHFFFAOYSA-M |
| XLogP | -2.50 |
| TPSA | 84.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;butane-1-sulfonic acid;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;butane-1-sulfonic acid;hydroxide?
The IUPAC name of sodium;butane-1-sulfonic acid;hydroxide (CID 175272255) is sodium;butane-1-sulfonic acid;hydroxide.
What is the SMILES notation for sodium;butane-1-sulfonic acid;hydroxide?
The canonical SMILES for sodium;butane-1-sulfonic acid;hydroxide is CCCCS(=O)(=O)O.[Na+].[OH-].
What is the InChIKey of sodium;butane-1-sulfonic acid;hydroxide?
The InChIKey is OLQHNSZWLPRPID-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10O3S.Na.H2O/c1-2-3-4-8(5,6)7;;/h2-4H2,1H3,(H,5,6,7);;1H2/q;+1;/p-1.
What are the key properties of sodium;butane-1-sulfonic acid;hydroxide?
sodium;butane-1-sulfonic acid;hydroxide has a molecular weight of 178.18 g/mol, XLogP of -2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;butane-1-sulfonic acid;hydroxide is sourced from PubChem (CID 175272255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).