C12H22O4S2 — CID 5286933
(1Z,3E)-1,4-bis(butylsulfonyl)buta-1,3-diene (PubChem CID 5286933) has the molecular formula C12H22O4S2 and a molecular weight of 294.44 g/mol. Its IUPAC name is (1Z,3E)-1,4-bis(butylsulfonyl)buta-1,3-diene.
| Compound Name | (1Z,3E)-1,4-bis(butylsulfonyl)buta-1,3-diene |
|---|---|
| PubChem CID | 5286933 |
| Molecular Formula | C12H22O4S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (1Z,3E)-1,4-bis(butylsulfonyl)buta-1,3-diene |
| SMILES | CCCCS(=O)(=O)/C=C\C=C\S(=O)(=O)CCCC |
| InChI | InChI=1S/C12H22O4S2/c1-3-5-9-17(13,14)11-7-8-12-18(15,16)10-6-4-2/h7-8,11-12H,3-6,9-10H2,1-2H3/b11-7-,12-8+ |
| InChIKey | AWAPBXGSDGWNHK-NTLHZVPKSA-N |
| XLogP | 2.44 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|