C10H16O4S2 — CID 57048521
1,6-bis(ethylsulfonyl)hexa-1,3,5-triene (PubChem CID 57048521) has the molecular formula C10H16O4S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 1,6-bis(ethylsulfonyl)hexa-1,3,5-triene.
| Compound Name | 1,6-bis(ethylsulfonyl)hexa-1,3,5-triene |
|---|---|
| PubChem CID | 57048521 |
| Molecular Formula | C10H16O4S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1,6-bis(ethylsulfonyl)hexa-1,3,5-triene |
| SMILES | CCS(=O)(=O)C=CC=CC=CS(=O)(=O)CC |
| InChI | InChI=1S/C10H16O4S2/c1-3-15(11,12)9-7-5-6-8-10-16(13,14)4-2/h5-10H,3-4H2,1-2H3 |
| InChIKey | YSKKCEMVYDAZFL-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|