C14H18O4S2 — CID 57028343
1,4-bis(2-ethylsulfonylethenyl)benzene (PubChem CID 57028343) has the molecular formula C14H18O4S2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1,4-bis(2-ethylsulfonylethenyl)benzene.
| Compound Name | 1,4-bis(2-ethylsulfonylethenyl)benzene |
|---|---|
| PubChem CID | 57028343 |
| Molecular Formula | C14H18O4S2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 1,4-bis(2-ethylsulfonylethenyl)benzene |
| SMILES | CCS(=O)(=O)C=Cc1ccc(C=CS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C14H18O4S2/c1-3-19(15,16)11-9-13-5-7-14(8-6-13)10-12-20(17,18)4-2/h5-12H,3-4H2,1-2H3 |
| InChIKey | WQGCGRZCVYIJMR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |