C14H26O4S2 — CID 173411073
1-(4-pentylsulfonylbuta-1,3-dienylsulfonyl)pentane (PubChem CID 173411073) has the molecular formula C14H26O4S2 and a molecular weight of 322.49 g/mol. Its IUPAC name is 1-(4-pentylsulfonylbuta-1,3-dienylsulfonyl)pentane.
| Compound Name | 1-(4-pentylsulfonylbuta-1,3-dienylsulfonyl)pentane |
|---|---|
| PubChem CID | 173411073 |
| Molecular Formula | C14H26O4S2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 1-(4-pentylsulfonylbuta-1,3-dienylsulfonyl)pentane |
| SMILES | CCCCCS(=O)(=O)C=CC=CS(=O)(=O)CCCCC |
| InChI | InChI=1S/C14H26O4S2/c1-3-5-7-11-19(15,16)13-9-10-14-20(17,18)12-8-6-4-2/h9-10,13-14H,3-8,11-12H2,1-2H3 |
| InChIKey | CZAKRTVANSZIES-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|