C9H19IN2O2S — CID 10831413
N'-(4-iodo-3,3-dimethylbutyl)sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 10831413) has the molecular formula C9H19IN2O2S and a molecular weight of 346.23 g/mol. Its IUPAC name is N'-(4-iodo-3,3-dimethylbutyl)sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-(4-iodo-3,3-dimethylbutyl)sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 10831413 |
| Molecular Formula | C9H19IN2O2S |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | N'-(4-iodo-3,3-dimethylbutyl)sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/S(=O)(=O)CCC(C)(C)CI |
| InChI | InChI=1S/C9H19IN2O2S/c1-9(2,7-10)5-6-15(13,14)11-8-12(3)4/h8H,5-7H2,1-4H3/b11-8+ |
| InChIKey | CETPHCSJWJXZCR-DHZHZOJOSA-N |
| XLogP | 1.76 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|