C10H15N3O2S — CID 173497553
N'-(2-amino-3-methylphenyl)sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 173497553) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is N'-(2-amino-3-methylphenyl)sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-(2-amino-3-methylphenyl)sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 173497553 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | N'-(2-amino-3-methylphenyl)sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | Cc1cccc(S(=O)(=O)N=CN(C)C)c1N |
| InChI | InChI=1S/C10H15N3O2S/c1-8-5-4-6-9(10(8)11)16(14,15)12-7-13(2)3/h4-7H,11H2,1-3H3 |
| InChIKey | ZLZYCJFMHUZLQU-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|