C11H15BrN2O3S — CID 155244783
N'-(2-bromo-6-ethoxyphenyl)sulfonyl-N,N-dimethylmethanimidamide (PubChem CID 155244783) has the molecular formula C11H15BrN2O3S and a molecular weight of 335.22 g/mol. Its IUPAC name is N'-(2-bromo-6-ethoxyphenyl)sulfonyl-N,N-dimethylmethanimidamide.
| Compound Name | N'-(2-bromo-6-ethoxyphenyl)sulfonyl-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 155244783 |
| Molecular Formula | C11H15BrN2O3S |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | N'-(2-bromo-6-ethoxyphenyl)sulfonyl-N,N-dimethylmethanimidamide |
| SMILES | CCOc1cccc(Br)c1S(=O)(=O)/N=C/N(C)C |
| InChI | InChI=1S/C11H15BrN2O3S/c1-4-17-10-7-5-6-9(12)11(10)18(15,16)13-8-14(2)3/h5-8H,4H2,1-3H3/b13-8+ |
| InChIKey | NWSSKTJTCYRRFX-MDWZMJQESA-N |
| XLogP | 2.13 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|