C8H5BrF3NO2S — CID 177485422
(NE)-N-[(2-bromophenyl)methylidene]-1,1,1-trifluoromethanesulfonamide (PubChem CID 177485422) has the molecular formula C8H5BrF3NO2S and a molecular weight of 316.10 g/mol. Its IUPAC name is (NE)-N-[(2-bromophenyl)methylidene]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | (NE)-N-[(2-bromophenyl)methylidene]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 177485422 |
| Molecular Formula | C8H5BrF3NO2S |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 314.92 |
| IUPAC Name | (NE)-N-[(2-bromophenyl)methylidene]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(/N=C/c1ccccc1Br)C(F)(F)F |
| InChI | InChI=1S/C8H5BrF3NO2S/c9-7-4-2-1-3-6(7)5-13-16(14,15)8(10,11)12/h1-5H/b13-5+ |
| InChIKey | UMHLMSBKUDFKKC-WLRTZDKTSA-N |
| XLogP | 2.72 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|