C4H9IN2S — CID 71376412
3-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-amine iodide (PubChem CID 71376412) has the molecular formula C4H9IN2S and a molecular weight of 244.10 g/mol. Its IUPAC name is 3-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-amine iodide.
| Compound Name | 3-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-amine iodide |
|---|---|
| PubChem CID | 71376412 |
| Molecular Formula | C4H9IN2S |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | 3-methyl-4,5-dihydro-1,3-thiazol-3-ium-2-amine iodide |
| SMILES | C[N+]1=C(N)SCC1.[I-] |
| InChI | InChI=1S/C4H8N2S.HI/c1-6-2-3-7-4(6)5;/h5H,2-3H2,1H3;1H |
| InChIKey | YBQSXVIUCDNVNV-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 29.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|