C11H18N6O — CID 123148033
1-N'-(2-hydroxyethyl)-3-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide (PubChem CID 123148033) has the molecular formula C11H18N6O and a molecular weight of 250.31 g/mol. Its IUPAC name is 1-N'-(2-hydroxyethyl)-3-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide.
| Compound Name | 1-N'-(2-hydroxyethyl)-3-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide |
|---|---|
| PubChem CID | 123148033 |
| Molecular Formula | C11H18N6O |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-N'-(2-hydroxyethyl)-3-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanediimidamide |
| SMILES | C/C=C/c1cc(/N=C(\N)C/C(N)=N/CCO)n[nH]1 |
| InChI | InChI=1S/C11H18N6O/c1-2-3-8-6-11(17-16-8)15-10(13)7-9(12)14-4-5-18/h2-3,6,18H,4-5,7H2,1H3,(H2,12,14)(H3,13,15,16,17)/b3-2+ |
| InChIKey | RTEAJDQJLSUYKK-NSCUHMNNSA-N |
| XLogP | 0.17 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|