C24H16F3IN4O4 — CID 123148174
methyl 2-[6-[5-[3-cyano-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]-4-iodo-2,4-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetate (PubChem CID 123148174) has the molecular formula C24H16F3IN4O4 and a molecular weight of 608.31 g/mol. Its IUPAC name is methyl 2-[6-[5-[3-cyano-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]-4-iodo-2,4-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetate.
| Compound Name | methyl 2-[6-[5-[3-cyano-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]-4-iodo-2,4-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetate |
|---|---|
| PubChem CID | 123148174 |
| Molecular Formula | C24H16F3IN4O4 |
| Molecular Weight | 608.31 g/mol |
| Exact Mass | 608.02 |
| IUPAC Name | methyl 2-[6-[5-[3-cyano-5-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-3-yl]-4-iodo-2,4-dihydro-1H-pyrrolo[1,2-a]indol-3-yl]acetate |
| SMILES | COC(=O)CC1=C2C(I)c3cc(-c4noc(-c5cc(C#N)cc(OC(F)(F)F)c5)n4)ccc3N2CC1 |
| InChI | InChI=1S/C24H16F3IN4O4/c1-34-19(33)10-13-4-5-32-18-3-2-14(9-17(18)20(28)21(13)32)22-30-23(36-31-22)15-6-12(11-29)7-16(8-15)35-24(25,26)27/h2-3,6-9,20H,4-5,10H2,1H3 |
| InChIKey | VWACEKCHGMYXFD-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 101.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.31 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|